C26H33N4O4+ — CID 170359766
N-[(3Z)-3-[[(4-cyclopropyl-4-hydroxycyclohexyl)methylideneamino]methylidene]-6-ethoxy-4-iminocyclohexa-1,5-dien-1-yl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide (PubChem CID 170359766) has the molecular formula C26H33N4O4+ and a molecular weight of 465.57 g/mol. Its IUPAC name is N-[(3Z)-3-[[(4-cyclopropyl-4-hydroxycyclohexyl)methylideneamino]methylidene]-6-ethoxy-4-iminocyclohexa-1,5-dien-1-yl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[(3Z)-3-[[(4-cyclopropyl-4-hydroxycyclohexyl)methylideneamino]methylidene]-6-ethoxy-4-iminocyclohexa-1,5-dien-1-yl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170359766 |
| Molecular Formula | C26H33N4O4+ |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | N-[(3Z)-3-[[(4-cyclopropyl-4-hydroxycyclohexyl)methylideneamino]methylidene]-6-ethoxy-4-iminocyclohexa-1,5-dien-1-yl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide |
| SMILES | [H]/N=C1\C=C(OCC)C(NC(=O)c2cccc(C)[n+]2O)=C\C1=C\N=C\C1CCC(O)(C2CC2)CC1 |
| InChI | InChI=1S/C26H32N4O4/c1-3-34-24-14-21(27)19(13-22(24)29-25(31)23-6-4-5-17(2)30(23)33)16-28-15-18-9-11-26(32,12-10-18)20-7-8-20/h4-6,13-16,18,20,27,32H,3,7-12H2,1-2H3,(H-,29,31,33)/p+1/b27-21+ |
| InChIKey | JQFWZECWWIBCRN-SZXQPVLSSA-O |
| XLogP | 3.37 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|