C26H31N4O4+ — CID 170354739
N-[4-amino-2-ethoxy-5-[(4-ethynyl-4-hydroxycyclohexyl)iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide (PubChem CID 170354739) has the molecular formula C26H31N4O4+ and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[4-amino-2-ethoxy-5-[(4-ethynyl-4-hydroxycyclohexyl)iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-amino-2-ethoxy-5-[(4-ethynyl-4-hydroxycyclohexyl)iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170354739 |
| Molecular Formula | C26H31N4O4+ |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-[4-amino-2-ethoxy-5-[(4-ethynyl-4-hydroxycyclohexyl)iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide |
| SMILES | C#CC1(O)CCC(/N=C/c2cc(NC(=O)c3cccc(C4CC4)[n+]3O)c(OCC)cc2N)CC1 |
| InChI | InChI=1S/C26H30N4O4/c1-3-26(32)12-10-19(11-13-26)28-16-18-14-21(24(34-4-2)15-20(18)27)29-25(31)23-7-5-6-22(30(23)33)17-8-9-17/h1,5-7,14-17,19,27,31-33H,4,8-13H2,2H3/p+1/b28-16+ |
| InChIKey | VWIVTMBXVOHUJX-LQKURTRISA-O |
| XLogP | 3.05 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|