C26H33FN4O3S — CID 170362921
N-[4-amino-5-[(4-cyclopropyl-4-hydroxycyclohexyl)iminomethyl]-2-ethoxyphenyl]-3-(1-fluoroethyl)thiazepine-7-carboxamide (PubChem CID 170362921) has the molecular formula C26H33FN4O3S and a molecular weight of 500.64 g/mol. Its IUPAC name is N-[4-amino-5-[(4-cyclopropyl-4-hydroxycyclohexyl)iminomethyl]-2-ethoxyphenyl]-3-(1-fluoroethyl)thiazepine-7-carboxamide.
| Compound Name | N-[4-amino-5-[(4-cyclopropyl-4-hydroxycyclohexyl)iminomethyl]-2-ethoxyphenyl]-3-(1-fluoroethyl)thiazepine-7-carboxamide |
|---|---|
| PubChem CID | 170362921 |
| Molecular Formula | C26H33FN4O3S |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | N-[4-amino-5-[(4-cyclopropyl-4-hydroxycyclohexyl)iminomethyl]-2-ethoxyphenyl]-3-(1-fluoroethyl)thiazepine-7-carboxamide |
| SMILES | CCOc1cc(N)c(/C=N/C2CCC(O)(C3CC3)CC2)cc1NC(=O)C1=CC=CC(C(C)F)=NS1 |
| InChI | InChI=1S/C26H33FN4O3S/c1-3-34-23-14-20(28)17(15-29-19-9-11-26(33,12-10-19)18-7-8-18)13-22(23)30-25(32)24-6-4-5-21(16(2)27)31-35-24/h4-6,13-16,18-19,33H,3,7-12,28H2,1-2H3,(H,30,32)/b29-15+ |
| InChIKey | RZQWFJJSAHASCE-WKULSOCRSA-N |
| XLogP | 5.01 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|