C17H20N2O6S — CID 87367296
3-[(4-amino-2,5-diethoxyphenyl)carbamoyl]benzenesulfonic acid (PubChem CID 87367296) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is 3-[(4-amino-2,5-diethoxyphenyl)carbamoyl]benzenesulfonic acid.
| Compound Name | 3-[(4-amino-2,5-diethoxyphenyl)carbamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87367296 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-[(4-amino-2,5-diethoxyphenyl)carbamoyl]benzenesulfonic acid |
| SMILES | CCOc1cc(NC(=O)c2cccc(S(=O)(=O)O)c2)c(OCC)cc1N |
| InChI | InChI=1S/C17H20N2O6S/c1-3-24-15-10-14(16(25-4-2)9-13(15)18)19-17(20)11-6-5-7-12(8-11)26(21,22)23/h5-10H,3-4,18H2,1-2H3,(H,19,20)(H,21,22,23) |
| InChIKey | UELCBRIJOAZHGL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|