C19H20N4O3+2 — CID 170356215
[(Z)-[3-[(6-cyclopropyl-1-hydroxypyridin-1-ium-2-carbonyl)amino]-4-ethoxy-6-iminocyclohexa-2,4-dien-1-ylidene]methyl]-methylidyneazanium (PubChem CID 170356215) has the molecular formula C19H20N4O3+2 and a molecular weight of 352.39 g/mol. Its IUPAC name is [(Z)-[3-[(6-cyclopropyl-1-hydroxypyridin-1-ium-2-carbonyl)amino]-4-ethoxy-6-iminocyclohexa-2,4-dien-1-ylidene]methyl]-methylidyneazanium.
| Compound Name | [(Z)-[3-[(6-cyclopropyl-1-hydroxypyridin-1-ium-2-carbonyl)amino]-4-ethoxy-6-iminocyclohexa-2,4-dien-1-ylidene]methyl]-methylidyneazanium |
|---|---|
| PubChem CID | 170356215 |
| Molecular Formula | C19H20N4O3+2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [(Z)-[3-[(6-cyclopropyl-1-hydroxypyridin-1-ium-2-carbonyl)amino]-4-ethoxy-6-iminocyclohexa-2,4-dien-1-ylidene]methyl]-methylidyneazanium |
| SMILES | [H]/N=C1\C=C(OCC)C(NC(=O)c2cccc(C3CC3)[n+]2O)=C\C1=C\[N+]#C |
| InChI | InChI=1S/C19H19N4O3/c1-3-26-18-10-14(20)13(11-21-2)9-15(18)22-19(24)17-6-4-5-16(23(17)25)12-7-8-12/h2,4-6,9-12,20H,3,7-8H2,1H3,(H-,22,24,25)/q+1/p+1/b13-11-,20-14+ |
| InChIKey | SXSMMDOEQAFLMY-HAGWQPGGSA-O |
| XLogP | 2.50 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|