C24H30N4O5+2 — CID 170349455
N-[(Z)-[4-ethoxy-3-[(1-hydroxy-6-methoxypyridin-1-ium-2-carbonyl)amino]-6-iminocyclohexa-2,4-dien-1-ylidene]methyl]-4-hydroxy-4-methylcyclohexane-1-carbonitrilium (PubChem CID 170349455) has the molecular formula C24H30N4O5+2 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[(Z)-[4-ethoxy-3-[(1-hydroxy-6-methoxypyridin-1-ium-2-carbonyl)amino]-6-iminocyclohexa-2,4-dien-1-ylidene]methyl]-4-hydroxy-4-methylcyclohexane-1-carbonitrilium.
| Compound Name | N-[(Z)-[4-ethoxy-3-[(1-hydroxy-6-methoxypyridin-1-ium-2-carbonyl)amino]-6-iminocyclohexa-2,4-dien-1-ylidene]methyl]-4-hydroxy-4-methylcyclohexane-1-carbonitrilium |
|---|---|
| PubChem CID | 170349455 |
| Molecular Formula | C24H30N4O5+2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-[(Z)-[4-ethoxy-3-[(1-hydroxy-6-methoxypyridin-1-ium-2-carbonyl)amino]-6-iminocyclohexa-2,4-dien-1-ylidene]methyl]-4-hydroxy-4-methylcyclohexane-1-carbonitrilium |
| SMILES | [H]/N=C1\C=C(OCC)C(NC(=O)c2cccc(OC)[n+]2O)=C\C1=C\[N+]#CC1CCC(C)(O)CC1 |
| InChI | InChI=1S/C24H29N4O5/c1-4-33-21-13-18(25)17(15-26-14-16-8-10-24(2,30)11-9-16)12-19(21)27-23(29)20-6-5-7-22(32-3)28(20)31/h5-7,12-13,15-16,25,30H,4,8-11H2,1-3H3,(H-,27,29,31)/q+1/p+1/b17-15-,25-18+ |
| InChIKey | BJMXRSBUGMVQPR-XWKNSEBLSA-O |
| XLogP | 2.95 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|