C23H30N4O3 — CID 155752328
N-[4-amino-5-(cyclohexyliminomethyl)-2-(2-hydroxypropan-2-yl)phenyl]-6-methoxypyridine-2-carboxamide (PubChem CID 155752328) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[4-amino-5-(cyclohexyliminomethyl)-2-(2-hydroxypropan-2-yl)phenyl]-6-methoxypyridine-2-carboxamide.
| Compound Name | N-[4-amino-5-(cyclohexyliminomethyl)-2-(2-hydroxypropan-2-yl)phenyl]-6-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 155752328 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-[4-amino-5-(cyclohexyliminomethyl)-2-(2-hydroxypropan-2-yl)phenyl]-6-methoxypyridine-2-carboxamide |
| SMILES | COc1cccc(C(=O)Nc2cc(/C=N/C3CCCCC3)c(N)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C23H30N4O3/c1-23(2,29)17-13-18(24)15(14-25-16-8-5-4-6-9-16)12-20(17)27-22(28)19-10-7-11-21(26-19)30-3/h7,10-14,16,29H,4-6,8-9,24H2,1-3H3,(H,27,28)/b25-14+ |
| InChIKey | OHCBNSWUGNDARF-AFUMVMLFSA-N |
| XLogP | 3.90 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|