C22H25F3N4O3 — CID 166774494
N-[4-amino-5-[[3-(2-hydroxypropan-2-yl)cyclobutyl]iminomethyl]-2-methoxyphenyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 166774494) has the molecular formula C22H25F3N4O3 and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[4-amino-5-[[3-(2-hydroxypropan-2-yl)cyclobutyl]iminomethyl]-2-methoxyphenyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[4-amino-5-[[3-(2-hydroxypropan-2-yl)cyclobutyl]iminomethyl]-2-methoxyphenyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166774494 |
| Molecular Formula | C22H25F3N4O3 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[4-amino-5-[[3-(2-hydroxypropan-2-yl)cyclobutyl]iminomethyl]-2-methoxyphenyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COc1cc(N)c(/C=N/C2CC(C(C)(C)O)C2)cc1NC(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C22H25F3N4O3/c1-21(2,31)14-7-15(8-14)27-11-13-6-17(18(32-3)9-16(13)26)29-20(30)12-4-5-19(28-10-12)22(23,24)25/h4-6,9-11,14-15,31H,7-8,26H2,1-3H3,(H,29,30)/b27-11+ |
| InChIKey | OBXHBSBRHWOWJF-LUOAPIJWSA-N |
| XLogP | 3.91 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|