C24H28FN7O3 — CID 166537231
tert-butyl 4-[[2-amino-4-fluoro-5-(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)phenyl]methylideneamino]piperidine-1-carboxylate (PubChem CID 166537231) has the molecular formula C24H28FN7O3 and a molecular weight of 481.53 g/mol. Its IUPAC name is tert-butyl 4-[[2-amino-4-fluoro-5-(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)phenyl]methylideneamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-amino-4-fluoro-5-(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)phenyl]methylideneamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166537231 |
| Molecular Formula | C24H28FN7O3 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | tert-butyl 4-[[2-amino-4-fluoro-5-(pyrazolo[1,5-a]pyrimidine-3-carbonylamino)phenyl]methylideneamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(/N=C/c2cc(NC(=O)c3cnn4cccnc34)c(F)cc2N)CC1 |
| InChI | InChI=1S/C24H28FN7O3/c1-24(2,3)35-23(34)31-9-5-16(6-10-31)28-13-15-11-20(18(25)12-19(15)26)30-22(33)17-14-29-32-8-4-7-27-21(17)32/h4,7-8,11-14,16H,5-6,9-10,26H2,1-3H3,(H,30,33)/b28-13+ |
| InChIKey | IBZFYQYPXQYAQT-XODNFHPESA-N |
| XLogP | 3.52 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|