C27H36ClN7O4 — CID 174029330
tert-butyl 4-[[2-amino-5-[[3-amino-2-(5-chloropyrimidin-2-yl)prop-2-enoyl]amino]-4-(2-hydroxypropan-2-yl)phenyl]methylideneamino]piperidine-1-carboxylate (PubChem CID 174029330) has the molecular formula C27H36ClN7O4 and a molecular weight of 558.08 g/mol. Its IUPAC name is tert-butyl 4-[[2-amino-5-[[3-amino-2-(5-chloropyrimidin-2-yl)prop-2-enoyl]amino]-4-(2-hydroxypropan-2-yl)phenyl]methylideneamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-amino-5-[[3-amino-2-(5-chloropyrimidin-2-yl)prop-2-enoyl]amino]-4-(2-hydroxypropan-2-yl)phenyl]methylideneamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174029330 |
| Molecular Formula | C27H36ClN7O4 |
| Molecular Weight | 558.08 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | tert-butyl 4-[[2-amino-5-[[3-amino-2-(5-chloropyrimidin-2-yl)prop-2-enoyl]amino]-4-(2-hydroxypropan-2-yl)phenyl]methylideneamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(/N=C/c2cc(NC(=O)C(=CN)c3ncc(Cl)cn3)c(C(C)(C)O)cc2N)CC1 |
| InChI | InChI=1S/C27H36ClN7O4/c1-26(2,3)39-25(37)35-8-6-18(7-9-35)31-13-16-10-22(20(11-21(16)30)27(4,5)38)34-24(36)19(12-29)23-32-14-17(28)15-33-23/h10-15,18,38H,6-9,29-30H2,1-5H3,(H,34,36)/b19-12?,31-13+ |
| InChIKey | COHZOONFQCFJKX-OUKQLDTPSA-N |
| XLogP | 3.70 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.08 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|