C16H21ClF3N3O2 — CID 87246935
tert-butyl 4-[3-amino-6-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-1-carboxylate (PubChem CID 87246935) has the molecular formula C16H21ClF3N3O2 and a molecular weight of 379.81 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-6-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-6-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87246935 |
| Molecular Formula | C16H21ClF3N3O2 |
| Molecular Weight | 379.81 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | tert-butyl 4-[3-amino-6-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc(Cl)c(C(F)(F)F)cc2N)CC1 |
| InChI | InChI=1S/C16H21ClF3N3O2/c1-15(2,3)25-14(24)23-6-4-9(5-7-23)12-11(21)8-10(13(17)22-12)16(18,19)20/h8-9H,4-7,21H2,1-3H3 |
| InChIKey | WPPQWHSMSRPCKJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|