C22H27ClN6O2 — CID 164921041
tert-butyl 4-[[(Z)-4-amino-3-(5-chloro-3-cyanoimidazo[1,2-a]pyridin-7-yl)but-3-en-2-ylidene]amino]piperidine-1-carboxylate (PubChem CID 164921041) has the molecular formula C22H27ClN6O2 and a molecular weight of 442.95 g/mol. Its IUPAC name is tert-butyl 4-[[(Z)-4-amino-3-(5-chloro-3-cyanoimidazo[1,2-a]pyridin-7-yl)but-3-en-2-ylidene]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(Z)-4-amino-3-(5-chloro-3-cyanoimidazo[1,2-a]pyridin-7-yl)but-3-en-2-ylidene]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164921041 |
| Molecular Formula | C22H27ClN6O2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | tert-butyl 4-[[(Z)-4-amino-3-(5-chloro-3-cyanoimidazo[1,2-a]pyridin-7-yl)but-3-en-2-ylidene]amino]piperidine-1-carboxylate |
| SMILES | CC(=N\C1CCN(C(=O)OC(C)(C)C)CC1)/C(=C\N)c1cc(Cl)n2c(C#N)cnc2c1 |
| InChI | InChI=1S/C22H27ClN6O2/c1-14(27-16-5-7-28(8-6-16)21(30)31-22(2,3)4)18(12-25)15-9-19(23)29-17(11-24)13-26-20(29)10-15/h9-10,12-13,16H,5-8,25H2,1-4H3/b18-12+,27-14+ |
| InChIKey | VSTJQWWIZJOCGO-GJYSMWALSA-N |
| XLogP | 4.02 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|