C23H31N7O3 — CID 164920733
tert-butyl 4-[[(1Z)-1-(3-cyano-5-methoxyimidazo[1,2-a]pyridin-7-yl)-1-hydrazinylidenepropan-2-ylidene]amino]azepane-1-carboxylate (PubChem CID 164920733) has the molecular formula C23H31N7O3 and a molecular weight of 453.55 g/mol. Its IUPAC name is tert-butyl 4-[[(1Z)-1-(3-cyano-5-methoxyimidazo[1,2-a]pyridin-7-yl)-1-hydrazinylidenepropan-2-ylidene]amino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[[(1Z)-1-(3-cyano-5-methoxyimidazo[1,2-a]pyridin-7-yl)-1-hydrazinylidenepropan-2-ylidene]amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 164920733 |
| Molecular Formula | C23H31N7O3 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | tert-butyl 4-[[(1Z)-1-(3-cyano-5-methoxyimidazo[1,2-a]pyridin-7-yl)-1-hydrazinylidenepropan-2-ylidene]amino]azepane-1-carboxylate |
| SMILES | COc1cc(C(=N/N)/C(C)=N/C2CCCN(C(=O)OC(C)(C)C)CC2)cc2ncc(C#N)n12 |
| InChI | InChI=1S/C23H31N7O3/c1-15(27-17-7-6-9-29(10-8-17)22(31)33-23(2,3)4)21(28-25)16-11-19-26-14-18(13-24)30(19)20(12-16)32-5/h11-12,14,17H,6-10,25H2,1-5H3/b27-15+,28-21+ |
| InChIKey | BNAYXEDLWBMSBP-SQGBZJBISA-N |
| XLogP | 3.13 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|