C22H32N6O3 — CID 164921136
tert-butyl 4-[[(1Z)-1-hydrazinylidene-1-(5-methoxyimidazo[1,2-a]pyridin-7-yl)propan-2-ylidene]amino]azepane-1-carboxylate (PubChem CID 164921136) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is tert-butyl 4-[[(1Z)-1-hydrazinylidene-1-(5-methoxyimidazo[1,2-a]pyridin-7-yl)propan-2-ylidene]amino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[[(1Z)-1-hydrazinylidene-1-(5-methoxyimidazo[1,2-a]pyridin-7-yl)propan-2-ylidene]amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 164921136 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | tert-butyl 4-[[(1Z)-1-hydrazinylidene-1-(5-methoxyimidazo[1,2-a]pyridin-7-yl)propan-2-ylidene]amino]azepane-1-carboxylate |
| SMILES | COc1cc(C(=N/N)/C(C)=N/C2CCCN(C(=O)OC(C)(C)C)CC2)cc2nccn12 |
| InChI | InChI=1S/C22H32N6O3/c1-15(20(26-23)16-13-18-24-9-12-28(18)19(14-16)30-5)25-17-7-6-10-27(11-8-17)21(29)31-22(2,3)4/h9,12-14,17H,6-8,10-11,23H2,1-5H3/b25-15+,26-20+ |
| InChIKey | IFGRRFXTAUXSFD-CZAQHAADSA-N |
| XLogP | 3.26 |
| TPSA | 106.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|