C20H28N6O3 — CID 169267540
tert-butyl 4-[[(1Z)-1-hydrazinylidene-1-(5-oxo-1H-imidazo[1,2-a]pyridin-7-yl)propan-2-ylidene]amino]piperidine-1-carboxylate (PubChem CID 169267540) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl 4-[[(1Z)-1-hydrazinylidene-1-(5-oxo-1H-imidazo[1,2-a]pyridin-7-yl)propan-2-ylidene]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(1Z)-1-hydrazinylidene-1-(5-oxo-1H-imidazo[1,2-a]pyridin-7-yl)propan-2-ylidene]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169267540 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | tert-butyl 4-[[(1Z)-1-hydrazinylidene-1-(5-oxo-1H-imidazo[1,2-a]pyridin-7-yl)propan-2-ylidene]amino]piperidine-1-carboxylate |
| SMILES | CC(=N\C1CCN(C(=O)OC(C)(C)C)CC1)/C(=N\N)c1cc(=O)n2cc[nH]c2c1 |
| InChI | InChI=1S/C20H28N6O3/c1-13(18(24-21)14-11-16-22-7-10-26(16)17(27)12-14)23-15-5-8-25(9-6-15)19(28)29-20(2,3)4/h7,10-12,15,22H,5-6,8-9,21H2,1-4H3/b23-13+,24-18+ |
| InChIKey | BUCOQYGDDSNCKE-DOWPPDCRSA-N |
| XLogP | 2.15 |
| TPSA | 117.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|