C31H40N8O3 — CID 164920979
tert-butyl 4-[[(1Z)-1-[3-cyano-5-(3-methyl-1-pyridin-2-ylbutoxy)imidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carboxylate (PubChem CID 164920979) has the molecular formula C31H40N8O3 and a molecular weight of 572.71 g/mol. Its IUPAC name is tert-butyl 4-[[(1Z)-1-[3-cyano-5-(3-methyl-1-pyridin-2-ylbutoxy)imidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(1Z)-1-[3-cyano-5-(3-methyl-1-pyridin-2-ylbutoxy)imidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164920979 |
| Molecular Formula | C31H40N8O3 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | tert-butyl 4-[[(1Z)-1-[3-cyano-5-(3-methyl-1-pyridin-2-ylbutoxy)imidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carboxylate |
| SMILES | CC(=N\C1CCN(C(=O)OC(C)(C)C)CC1)/C(=N\N)c1cc(OC(CC(C)C)c2ccccn2)n2c(C#N)cnc2c1 |
| InChI | InChI=1S/C31H40N8O3/c1-20(2)15-26(25-9-7-8-12-34-25)41-28-17-22(16-27-35-19-24(18-32)39(27)28)29(37-33)21(3)36-23-10-13-38(14-11-23)30(40)42-31(4,5)6/h7-9,12,16-17,19-20,23,26H,10-11,13-15,33H2,1-6H3/b36-21+,37-29+ |
| InChIKey | JXYLNIDIEDNOBC-WUXYMUPQSA-N |
| XLogP | 5.29 |
| TPSA | 143.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|