C27H29N9O — CID 164920658
7-[2-(1-cyano-2-cyclopropylpiperidin-4-yl)iminopropanehydrazonoyl]-5-(1-pyridin-2-ylethoxy)imidazo[1,2-a]pyridine-3-carbonitrile (PubChem CID 164920658) has the molecular formula C27H29N9O and a molecular weight of 495.59 g/mol. Its IUPAC name is 7-[2-(1-cyano-2-cyclopropylpiperidin-4-yl)iminopropanehydrazonoyl]-5-(1-pyridin-2-ylethoxy)imidazo[1,2-a]pyridine-3-carbonitrile.
| Compound Name | 7-[2-(1-cyano-2-cyclopropylpiperidin-4-yl)iminopropanehydrazonoyl]-5-(1-pyridin-2-ylethoxy)imidazo[1,2-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164920658 |
| Molecular Formula | C27H29N9O |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 7-[2-(1-cyano-2-cyclopropylpiperidin-4-yl)iminopropanehydrazonoyl]-5-(1-pyridin-2-ylethoxy)imidazo[1,2-a]pyridine-3-carbonitrile |
| SMILES | CC(=N\C1CCN(C#N)C(C2CC2)C1)/C(=N\N)c1cc(OC(C)c2ccccn2)n2c(C#N)cnc2c1 |
| InChI | InChI=1S/C27H29N9O/c1-17(33-21-8-10-35(16-29)24(13-21)19-6-7-19)27(34-30)20-11-25-32-15-22(14-28)36(25)26(12-20)37-18(2)23-5-3-4-9-31-23/h3-5,9,11-12,15,18-19,21,24H,6-8,10,13,30H2,1-2H3/b33-17+,34-27+ |
| InChIKey | PGZJTVPGNRNEDA-KCYJWMRQSA-N |
| XLogP | 3.59 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|