C28H33ClN8O3 — CID 164920819
tert-butyl 4-[[(1Z)-1-[5-[1-(6-chloro-3-pyridinyl)ethoxy]-3-cyanoimidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carboxylate (PubChem CID 164920819) has the molecular formula C28H33ClN8O3 and a molecular weight of 565.08 g/mol. Its IUPAC name is tert-butyl 4-[[(1Z)-1-[5-[1-(6-chloro-3-pyridinyl)ethoxy]-3-cyanoimidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(1Z)-1-[5-[1-(6-chloro-3-pyridinyl)ethoxy]-3-cyanoimidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164920819 |
| Molecular Formula | C28H33ClN8O3 |
| Molecular Weight | 565.08 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | tert-butyl 4-[[(1Z)-1-[5-[1-(6-chloro-3-pyridinyl)ethoxy]-3-cyanoimidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carboxylate |
| SMILES | CC(=N\C1CCN(C(=O)OC(C)(C)C)CC1)/C(=N\N)c1cc(OC(C)c2ccc(Cl)nc2)n2c(C#N)cnc2c1 |
| InChI | InChI=1S/C28H33ClN8O3/c1-17(34-21-8-10-36(11-9-21)27(38)40-28(3,4)5)26(35-31)20-12-24-33-16-22(14-30)37(24)25(13-20)39-18(2)19-6-7-23(29)32-15-19/h6-7,12-13,15-16,18,21H,8-11,31H2,1-5H3/b34-17+,35-26+ |
| InChIKey | SWVNQRARZWFYTH-DQBURHBASA-N |
| XLogP | 4.92 |
| TPSA | 143.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.08 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|