C26H30N8O3 — CID 164920909
tert-butyl 3-[[(1Z)-1-[3-cyano-5-(1-pyridin-2-ylethoxy)imidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]azetidine-1-carboxylate (PubChem CID 164920909) has the molecular formula C26H30N8O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is tert-butyl 3-[[(1Z)-1-[3-cyano-5-(1-pyridin-2-ylethoxy)imidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(1Z)-1-[3-cyano-5-(1-pyridin-2-ylethoxy)imidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 164920909 |
| Molecular Formula | C26H30N8O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | tert-butyl 3-[[(1Z)-1-[3-cyano-5-(1-pyridin-2-ylethoxy)imidazo[1,2-a]pyridin-7-yl]-1-hydrazinylidenepropan-2-ylidene]amino]azetidine-1-carboxylate |
| SMILES | CC(=N\C1CN(C(=O)OC(C)(C)C)C1)/C(=N\N)c1cc(OC(C)c2ccccn2)n2c(C#N)cnc2c1 |
| InChI | InChI=1S/C26H30N8O3/c1-16(31-19-14-33(15-19)25(35)37-26(3,4)5)24(32-28)18-10-22-30-13-20(12-27)34(22)23(11-18)36-17(2)21-8-6-7-9-29-21/h6-11,13,17,19H,14-15,28H2,1-5H3/b31-16+,32-24+ |
| InChIKey | ZSCPMVCMZGODOR-ZRIOLUCESA-N |
| XLogP | 3.48 |
| TPSA | 143.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|