C22H32F3N5O2 — CID 166536888
tert-butyl 3-[[4-[[2,5-diamino-4-(difluoromethyl)phenyl]methylideneamino]piperidin-1-yl]methyl]-3-fluoroazetidine-1-carboxylate (PubChem CID 166536888) has the molecular formula C22H32F3N5O2 and a molecular weight of 455.53 g/mol. Its IUPAC name is tert-butyl 3-[[4-[[2,5-diamino-4-(difluoromethyl)phenyl]methylideneamino]piperidin-1-yl]methyl]-3-fluoroazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-[[2,5-diamino-4-(difluoromethyl)phenyl]methylideneamino]piperidin-1-yl]methyl]-3-fluoroazetidine-1-carboxylate |
|---|---|
| PubChem CID | 166536888 |
| Molecular Formula | C22H32F3N5O2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | tert-butyl 3-[[4-[[2,5-diamino-4-(difluoromethyl)phenyl]methylideneamino]piperidin-1-yl]methyl]-3-fluoroazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(CN2CCC(/N=C/c3cc(N)c(C(F)F)cc3N)CC2)C1 |
| InChI | InChI=1S/C22H32F3N5O2/c1-21(2,3)32-20(31)30-12-22(25,13-30)11-29-6-4-15(5-7-29)28-10-14-8-18(27)16(19(23)24)9-17(14)26/h8-10,15,19H,4-7,11-13,26-27H2,1-3H3/b28-10+ |
| InChIKey | UTSRQYIMSTYBBZ-ORBVJSQLSA-N |
| XLogP | 3.63 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|