C20H16ClNOS — CID 167113340
11-chloro-6-methyl-3-phenyl-11H-benzo[c][2,1]benzothiazepine 5-oxide (PubChem CID 167113340) has the molecular formula C20H16ClNOS and a molecular weight of 353.87 g/mol. Its IUPAC name is 11-chloro-6-methyl-3-phenyl-11H-benzo[c][2,1]benzothiazepine 5-oxide.
| Compound Name | 11-chloro-6-methyl-3-phenyl-11H-benzo[c][2,1]benzothiazepine 5-oxide |
|---|---|
| PubChem CID | 167113340 |
| Molecular Formula | C20H16ClNOS |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 11-chloro-6-methyl-3-phenyl-11H-benzo[c][2,1]benzothiazepine 5-oxide |
| SMILES | CN1c2ccccc2C(Cl)c2ccc(-c3ccccc3)cc2S1=O |
| InChI | InChI=1S/C20H16ClNOS/c1-22-18-10-6-5-9-16(18)20(21)17-12-11-15(13-19(17)24(22)23)14-7-3-2-4-8-14/h2-13,20H,1H3 |
| InChIKey | GVDZYDRKPYPFHM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|