C25H42N2O — CID 167113805
(E)-3-[tert-butyl(3,3-dimethylbutyl)amino]-1-[4-(dipropylamino)phenyl]prop-2-en-1-one (PubChem CID 167113805) has the molecular formula C25H42N2O and a molecular weight of 386.62 g/mol. Its IUPAC name is (E)-3-[tert-butyl(3,3-dimethylbutyl)amino]-1-[4-(dipropylamino)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[tert-butyl(3,3-dimethylbutyl)amino]-1-[4-(dipropylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167113805 |
| Molecular Formula | C25H42N2O |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.33 |
| IUPAC Name | (E)-3-[tert-butyl(3,3-dimethylbutyl)amino]-1-[4-(dipropylamino)phenyl]prop-2-en-1-one |
| SMILES | CCCN(CCC)c1ccc(C(=O)/C=C/N(CCC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H42N2O/c1-9-17-26(18-10-2)22-13-11-21(12-14-22)23(28)15-19-27(25(6,7)8)20-16-24(3,4)5/h11-15,19H,9-10,16-18,20H2,1-8H3/b19-15+ |
| InChIKey | BXPHSTBYMIHTDO-XDJHFCHBSA-N |
| XLogP | 6.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|