C26H33N5O3S — CID 167114197
3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-4-yl]-2-[(2,4,6-trimethylphenyl)sulfanylamino]propaneperoxoic acid (PubChem CID 167114197) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is 3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-4-yl]-2-[(2,4,6-trimethylphenyl)sulfanylamino]propaneperoxoic acid.
| Compound Name | 3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-4-yl]-2-[(2,4,6-trimethylphenyl)sulfanylamino]propaneperoxoic acid |
|---|---|
| PubChem CID | 167114197 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-4-yl]-2-[(2,4,6-trimethylphenyl)sulfanylamino]propaneperoxoic acid |
| SMILES | Cc1cc(C)c(SNC(Cc2cnn(CCCc3ccc4c(n3)NCCC4)c2)C(=O)OO)c(C)c1 |
| InChI | InChI=1S/C26H33N5O3S/c1-17-12-18(2)24(19(3)13-17)35-30-23(26(32)34-33)14-20-15-28-31(16-20)11-5-7-22-9-8-21-6-4-10-27-25(21)29-22/h8-9,12-13,15-16,23,30,33H,4-7,10-11,14H2,1-3H3,(H,27,29) |
| InChIKey | ZUXBUNUUCRYKDJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|