C25H22FN3O3S — CID 167114885
[5-(1,3-benzodioxol-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[3-(butylsulfanylamino)-2-fluorophenyl]methanone (PubChem CID 167114885) has the molecular formula C25H22FN3O3S and a molecular weight of 463.53 g/mol. Its IUPAC name is [5-(1,3-benzodioxol-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[3-(butylsulfanylamino)-2-fluorophenyl]methanone.
| Compound Name | [5-(1,3-benzodioxol-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[3-(butylsulfanylamino)-2-fluorophenyl]methanone |
|---|---|
| PubChem CID | 167114885 |
| Molecular Formula | C25H22FN3O3S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [5-(1,3-benzodioxol-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[3-(butylsulfanylamino)-2-fluorophenyl]methanone |
| SMILES | CCCCSNc1cccc(C(=O)c2c[nH]c3ncc(-c4ccc5c(c4)OCO5)cc23)c1F |
| InChI | InChI=1S/C25H22FN3O3S/c1-2-3-9-33-29-20-6-4-5-17(23(20)26)24(30)19-13-28-25-18(19)10-16(12-27-25)15-7-8-21-22(11-15)32-14-31-21/h4-8,10-13,29H,2-3,9,14H2,1H3,(H,27,28) |
| InChIKey | UWBPPSBBMCTSRK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|