C27H28FN3O5S — CID 174777207
N-butylsulfonyl-2-fluoro-3-[5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]benzeneamine oxide (PubChem CID 174777207) has the molecular formula C27H28FN3O5S and a molecular weight of 525.60 g/mol. Its IUPAC name is N-butylsulfonyl-2-fluoro-3-[5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]benzeneamine oxide.
| Compound Name | N-butylsulfonyl-2-fluoro-3-[5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]benzeneamine oxide |
|---|---|
| PubChem CID | 174777207 |
| Molecular Formula | C27H28FN3O5S |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N-butylsulfonyl-2-fluoro-3-[5-[4-(2-hydroxypropan-2-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]benzeneamine oxide |
| SMILES | CCCCS(=O)(=O)[NH+]([O-])c1cccc(C(=O)c2c[nH]c3ncc(-c4ccc(C(C)(C)O)cc4)cc23)c1F |
| InChI | InChI=1S/C27H28FN3O5S/c1-4-5-13-37(35,36)31(34)23-8-6-7-20(24(23)28)25(32)22-16-30-26-21(22)14-18(15-29-26)17-9-11-19(12-10-17)27(2,3)33/h6-12,14-16,31,33H,4-5,13H2,1-3H3,(H,29,30) |
| InChIKey | ZODMDEXWADYKFU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|