C21H29N3O3 — CID 167119422
2-[(4-tert-butylbenzoyl)amino]-2-methyl-5-(1-methylpyrazol-4-yl)pentanoic acid (PubChem CID 167119422) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[(4-tert-butylbenzoyl)amino]-2-methyl-5-(1-methylpyrazol-4-yl)pentanoic acid.
| Compound Name | 2-[(4-tert-butylbenzoyl)amino]-2-methyl-5-(1-methylpyrazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 167119422 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-[(4-tert-butylbenzoyl)amino]-2-methyl-5-(1-methylpyrazol-4-yl)pentanoic acid |
| SMILES | Cn1cc(CCCC(C)(NC(=O)c2ccc(C(C)(C)C)cc2)C(=O)O)cn1 |
| InChI | InChI=1S/C21H29N3O3/c1-20(2,3)17-10-8-16(9-11-17)18(25)23-21(4,19(26)27)12-6-7-15-13-22-24(5)14-15/h8-11,13-14H,6-7,12H2,1-5H3,(H,23,25)(H,26,27) |
| InChIKey | PCDGDKVQMQIGDI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |