C18H26FN3O15P2S — CID 167120886
[[(2R,3S,4R,5R)-4-amino-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate (PubChem CID 167120886) has the molecular formula C18H26FN3O15P2S and a molecular weight of 637.42 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-4-amino-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-4-amino-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 167120886 |
| Molecular Formula | C18H26FN3O15P2S |
| Molecular Weight | 637.42 g/mol |
| Exact Mass | 637.05 |
| IUPAC Name | [[(2R,3S,4R,5R)-4-amino-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
| SMILES | C#C[C@@]1(N)[C@H](O)[C@@H](COP(O)(=S)OP(=O)(O)OC2OC([C@@H](F)CO)C(O)C(O)C2O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C18H26FN3O15P2S/c1-2-18(20)14(28)8(34-16(18)22-4-3-9(24)21-17(22)29)6-33-39(32,40)37-38(30,31)36-15-12(27)10(25)11(26)13(35-15)7(19)5-23/h1,3-4,7-8,10-16,23,25-28H,5-6,20H2,(H,30,31)(H,32,40)(H,21,24,29)/t7-,8+,10?,11?,12?,13?,14+,15?,16+,18+,39?/m0/s1 |
| InChIKey | CKDIDBLLNPXAFE-XZJICENXSA-N |
| XLogP | -4.37 |
| TPSA | 285.71 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.42 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|