C30H29N7O2 — CID 167122586
2-[4-(6'-oxo-2'-pyridin-3-ylspiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrido[3,2-d]pyrimidine]-4'-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 167122586) has the molecular formula C30H29N7O2 and a molecular weight of 519.61 g/mol. Its IUPAC name is 2-[4-(6'-oxo-2'-pyridin-3-ylspiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrido[3,2-d]pyrimidine]-4'-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-(6'-oxo-2'-pyridin-3-ylspiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrido[3,2-d]pyrimidine]-4'-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 167122586 |
| Molecular Formula | C30H29N7O2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 2-[4-(6'-oxo-2'-pyridin-3-ylspiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrido[3,2-d]pyrimidine]-4'-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(c2nc(-c3cccnc3)nc3c2NC(=O)C2(CCCc4ccccc42)C3)CC1CC#N |
| InChI | InChI=1S/C30H29N7O2/c1-2-25(38)37-16-15-36(19-22(37)11-13-31)28-26-24(33-27(35-28)21-9-6-14-32-18-21)17-30(29(39)34-26)12-5-8-20-7-3-4-10-23(20)30/h2-4,6-7,9-10,14,18,22H,1,5,8,11-12,15-17,19H2,(H,34,39) |
| InChIKey | JPOUPAXSUKUZLY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|