C25H28N6O2 — CID 167122739
2-[(2S)-1-(1-hydroxyprop-2-enyl)-4-[(4R)-6'-oxospiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrido[3,2-d]pyrimidine]-4'-yl]piperazin-2-yl]acetonitrile (PubChem CID 167122739) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-[(2S)-1-(1-hydroxyprop-2-enyl)-4-[(4R)-6'-oxospiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrido[3,2-d]pyrimidine]-4'-yl]piperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-1-(1-hydroxyprop-2-enyl)-4-[(4R)-6'-oxospiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrido[3,2-d]pyrimidine]-4'-yl]piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 167122739 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2-[(2S)-1-(1-hydroxyprop-2-enyl)-4-[(4R)-6'-oxospiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrido[3,2-d]pyrimidine]-4'-yl]piperazin-2-yl]acetonitrile |
| SMILES | C=CC(O)N1CCN(c2ncnc3c2NC(=O)[C@]2(CCCc4ccccc42)C3)C[C@@H]1CC#N |
| InChI | InChI=1S/C25H28N6O2/c1-2-21(32)31-13-12-30(15-18(31)9-11-26)23-22-20(27-16-28-23)14-25(24(33)29-22)10-5-7-17-6-3-4-8-19(17)25/h2-4,6,8,16,18,21,32H,1,5,7,9-10,12-15H2,(H,29,33)/t18-,21?,25+/m0/s1 |
| InChIKey | LUMFQELHBKLQRQ-WXSMBBHDSA-N |
| XLogP | 2.15 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|