C32H42N6O3 — CID 167080166
2-[(2S)-4-[2,2-dimethyl-2'-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]spiro[1H-indene-3,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-4'-yl]-1-(1-hydroxyprop-2-enyl)piperazin-2-yl]acetonitrile (PubChem CID 167080166) has the molecular formula C32H42N6O3 and a molecular weight of 558.73 g/mol. Its IUPAC name is 2-[(2S)-4-[2,2-dimethyl-2'-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]spiro[1H-indene-3,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-4'-yl]-1-(1-hydroxyprop-2-enyl)piperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-4-[2,2-dimethyl-2'-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]spiro[1H-indene-3,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-4'-yl]-1-(1-hydroxyprop-2-enyl)piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 167080166 |
| Molecular Formula | C32H42N6O3 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | 2-[(2S)-4-[2,2-dimethyl-2'-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]spiro[1H-indene-3,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-4'-yl]-1-(1-hydroxyprop-2-enyl)piperazin-2-yl]acetonitrile |
| SMILES | C=CC(O)N1CCN(c2nc(OC[C@@H]3CCCN3C)nc3c2CCC2(O3)c3ccccc3CC2(C)C)C[C@@H]1CC#N |
| InChI | InChI=1S/C32H42N6O3/c1-5-27(39)38-18-17-37(20-23(38)13-15-33)28-25-12-14-32(26-11-7-6-9-22(26)19-31(32,2)3)41-29(25)35-30(34-28)40-21-24-10-8-16-36(24)4/h5-7,9,11,23-24,27,39H,1,8,10,12-14,16-21H2,2-4H3/t23-,24-,27?,32?/m0/s1 |
| InChIKey | YESFSOQWJNHMJR-ZDWKIUFESA-N |
| XLogP | 3.66 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|