C31H38N6O3 — CID 171904214
2-[(2S)-4-[(2R,3S)-2-methyl-2'-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]spiro[1,2-dihydroindene-3,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-4'-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 171904214) has the molecular formula C31H38N6O3 and a molecular weight of 542.68 g/mol. Its IUPAC name is 2-[(2S)-4-[(2R,3S)-2-methyl-2'-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]spiro[1,2-dihydroindene-3,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-4'-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-4-[(2R,3S)-2-methyl-2'-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]spiro[1,2-dihydroindene-3,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-4'-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 171904214 |
| Molecular Formula | C31H38N6O3 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | 2-[(2S)-4-[(2R,3S)-2-methyl-2'-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]spiro[1,2-dihydroindene-3,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-4'-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(c2nc(OC[C@@H]3CCCN3C)nc3c2CC[C@@]2(O3)c3ccccc3C[C@H]2C)C[C@@H]1CC#N |
| InChI | InChI=1S/C31H38N6O3/c1-4-27(38)37-17-16-36(19-23(37)12-14-32)28-25-11-13-31(21(2)18-22-8-5-6-10-26(22)31)40-29(25)34-30(33-28)39-20-24-9-7-15-35(24)3/h4-6,8,10,21,23-24H,1,7,9,11-13,15-20H2,2-3H3/t21-,23+,24+,31+/m1/s1 |
| InChIKey | DMNHSQGOAYPSHC-CVODFWCWSA-N |
| XLogP | 3.48 |
| TPSA | 94.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|