C13H5Cl2NO2 — CID 167129330
2,10-dichloro-[1]benzofuro[3,2-f][1,3]benzoxazole (PubChem CID 167129330) has the molecular formula C13H5Cl2NO2 and a molecular weight of 278.09 g/mol. Its IUPAC name is 2,10-dichloro-[1]benzofuro[3,2-f][1,3]benzoxazole.
| Compound Name | 2,10-dichloro-[1]benzofuro[3,2-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 167129330 |
| Molecular Formula | C13H5Cl2NO2 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 2,10-dichloro-[1]benzofuro[3,2-f][1,3]benzoxazole |
| SMILES | Clc1nc2cc3c(oc4ccccc43)c(Cl)c2o1 |
| InChI | InChI=1S/C13H5Cl2NO2/c14-10-11-7(5-8-12(10)18-13(15)16-8)6-3-1-2-4-9(6)17-11/h1-5H |
| InChIKey | GKPVWGIWOLKEMF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |