C21H20FN5O — CID 167130611
N-[4-[5-cyclopropyl-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]-2-pyridinyl]formamide (PubChem CID 167130611) has the molecular formula C21H20FN5O and a molecular weight of 377.42 g/mol. Its IUPAC name is N-[4-[5-cyclopropyl-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]-2-pyridinyl]formamide.
| Compound Name | N-[4-[5-cyclopropyl-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 167130611 |
| Molecular Formula | C21H20FN5O |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[4-[5-cyclopropyl-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]-2-pyridinyl]formamide |
| SMILES | O=CNc1cc(-c2c(-c3ccc(F)cc3)nn3c2CN(C2CC2)CC3)ccn1 |
| InChI | InChI=1S/C21H20FN5O/c22-16-3-1-14(2-4-16)21-20(15-7-8-23-19(11-15)24-13-28)18-12-26(17-5-6-17)9-10-27(18)25-21/h1-4,7-8,11,13,17H,5-6,9-10,12H2,(H,23,24,28) |
| InChIKey | SMVFLBKYRGDROL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|