C16H21BrN4O — CID 167132021
2-[5-(bromomethyl)-1-methylpyrazol-4-yl]-5-cyclohexyloxy-4-methylpyrimidine (PubChem CID 167132021) has the molecular formula C16H21BrN4O and a molecular weight of 365.28 g/mol. Its IUPAC name is 2-[5-(bromomethyl)-1-methylpyrazol-4-yl]-5-cyclohexyloxy-4-methylpyrimidine.
| Compound Name | 2-[5-(bromomethyl)-1-methylpyrazol-4-yl]-5-cyclohexyloxy-4-methylpyrimidine |
|---|---|
| PubChem CID | 167132021 |
| Molecular Formula | C16H21BrN4O |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-[5-(bromomethyl)-1-methylpyrazol-4-yl]-5-cyclohexyloxy-4-methylpyrimidine |
| SMILES | Cc1nc(-c2cnn(C)c2CBr)ncc1OC1CCCCC1 |
| InChI | InChI=1S/C16H21BrN4O/c1-11-15(22-12-6-4-3-5-7-12)10-18-16(20-11)13-9-19-21(2)14(13)8-17/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | BKTXHHSGGIKYRC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|