C23H34N4O3 — CID 170193605
butyl N-[[4-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-1-methylpyrazol-5-yl]methyl]-N-methylcarbamate (PubChem CID 170193605) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is butyl N-[[4-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-1-methylpyrazol-5-yl]methyl]-N-methylcarbamate.
| Compound Name | butyl N-[[4-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-1-methylpyrazol-5-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170193605 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | butyl N-[[4-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-1-methylpyrazol-5-yl]methyl]-N-methylcarbamate |
| SMILES | CCCCOC(=O)N(C)Cc1c(-c2ccc(OC3CCCCC3)c(C)n2)cnn1C |
| InChI | InChI=1S/C23H34N4O3/c1-5-6-14-29-23(28)26(3)16-21-19(15-24-27(21)4)20-12-13-22(17(2)25-20)30-18-10-8-7-9-11-18/h12-13,15,18H,5-11,14,16H2,1-4H3 |
| InChIKey | SCYCTFRBXOSADS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|