C22H32N4O3 — CID 175877099
[4-(5-cyclohexyloxy-2-pyridinyl)-1-methylpyrazol-5-yl]methyl N-butyl-N-methylcarbamate (PubChem CID 175877099) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is [4-(5-cyclohexyloxy-2-pyridinyl)-1-methylpyrazol-5-yl]methyl N-butyl-N-methylcarbamate.
| Compound Name | [4-(5-cyclohexyloxy-2-pyridinyl)-1-methylpyrazol-5-yl]methyl N-butyl-N-methylcarbamate |
|---|---|
| PubChem CID | 175877099 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | [4-(5-cyclohexyloxy-2-pyridinyl)-1-methylpyrazol-5-yl]methyl N-butyl-N-methylcarbamate |
| SMILES | CCCCN(C)C(=O)OCc1c(-c2ccc(OC3CCCCC3)cn2)cnn1C |
| InChI | InChI=1S/C22H32N4O3/c1-4-5-13-25(2)22(27)28-16-21-19(15-24-26(21)3)20-12-11-18(14-23-20)29-17-9-7-6-8-10-17/h11-12,14-15,17H,4-10,13,16H2,1-3H3 |
| InChIKey | YLJUYLWECNQOTN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |