C54H48N2 — CID 167133373
3-[3-(3,6-ditert-butylcarbazol-9-yl)-5-phenylphenyl]-N-(4-phenylphenyl)naphthalen-2-amine (PubChem CID 167133373) has the molecular formula C54H48N2 and a molecular weight of 724.99 g/mol. Its IUPAC name is 3-[3-(3,6-ditert-butylcarbazol-9-yl)-5-phenylphenyl]-N-(4-phenylphenyl)naphthalen-2-amine.
| Compound Name | 3-[3-(3,6-ditert-butylcarbazol-9-yl)-5-phenylphenyl]-N-(4-phenylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 167133373 |
| Molecular Formula | C54H48N2 |
| Molecular Weight | 724.99 g/mol |
| Exact Mass | 724.38 |
| IUPAC Name | 3-[3-(3,6-ditert-butylcarbazol-9-yl)-5-phenylphenyl]-N-(4-phenylphenyl)naphthalen-2-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(-c2ccccc2)cc(-c2cc3ccccc3cc2Nc2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C54H48N2/c1-53(2,3)43-23-27-51-48(34-43)49-35-44(54(4,5)6)24-28-52(49)56(51)46-30-41(37-17-11-8-12-18-37)29-42(31-46)47-32-39-19-13-14-20-40(39)33-50(47)55-45-25-21-38(22-26-45)36-15-9-7-10-16-36/h7-35,55H,1-6H3 |
| InChIKey | CMYIUOMNWQFULC-UHFFFAOYSA-N |
| XLogP | 15.28 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.99 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |