C15H28N4O4 — CID 167133855
N-[2-[(1-amino-5-methyl-4-oxoheptan-3-yl)amino]-2-oxoethyl]morpholine-2-carboxamide (PubChem CID 167133855) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[2-[(1-amino-5-methyl-4-oxoheptan-3-yl)amino]-2-oxoethyl]morpholine-2-carboxamide.
| Compound Name | N-[2-[(1-amino-5-methyl-4-oxoheptan-3-yl)amino]-2-oxoethyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 167133855 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | N-[2-[(1-amino-5-methyl-4-oxoheptan-3-yl)amino]-2-oxoethyl]morpholine-2-carboxamide |
| SMILES | CCC(C)C(=O)C(CCN)NC(=O)CNC(=O)C1CNCCO1 |
| InChI | InChI=1S/C15H28N4O4/c1-3-10(2)14(21)11(4-5-16)19-13(20)9-18-15(22)12-8-17-6-7-23-12/h10-12,17H,3-9,16H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | NWLINPILCWBTQX-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |