C32H36N10O — CID 167134153
2-N-[(8S)-8-(4-methylpiperazin-1-yl)-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-3-yl]-4-N-(5-methylquinoxalin-6-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 167134153) has the molecular formula C32H36N10O and a molecular weight of 576.71 g/mol. Its IUPAC name is 2-N-[(8S)-8-(4-methylpiperazin-1-yl)-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-3-yl]-4-N-(5-methylquinoxalin-6-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(8S)-8-(4-methylpiperazin-1-yl)-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-3-yl]-4-N-(5-methylquinoxalin-6-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 167134153 |
| Molecular Formula | C32H36N10O |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 2-N-[(8S)-8-(4-methylpiperazin-1-yl)-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-3-yl]-4-N-(5-methylquinoxalin-6-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1c(Nc2nc(Nc3ccc4c(c3)OCC3C[C@@H](N5CCN(C)CC5)CCN43)nc3[nH]ccc23)ccc2nccnc12 |
| InChI | InChI=1S/C32H36N10O/c1-20-25(4-5-26-29(20)34-11-10-33-26)37-31-24-7-9-35-30(24)38-32(39-31)36-21-3-6-27-28(17-21)43-19-23-18-22(8-12-42(23)27)41-15-13-40(2)14-16-41/h3-7,9-11,17,22-23H,8,12-16,18-19H2,1-2H3,(H3,35,36,37,38,39)/t22-,23?/m0/s1 |
| InChIKey | SJBZOBZKYWQCBT-NQCNTLBGSA-N |
| XLogP | 4.67 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |