C28H29N7O3 — CID 167135606
N-[4-[4-[[2-(aminomethylideneamino)-4-pyridinyl]oxy]-3-methylanilino]quinazolin-6-yl]-N-[2-(hydroxymethyl)-3-methylbut-3-enyl]formamide (PubChem CID 167135606) has the molecular formula C28H29N7O3 and a molecular weight of 511.59 g/mol. Its IUPAC name is N-[4-[4-[[2-(aminomethylideneamino)-4-pyridinyl]oxy]-3-methylanilino]quinazolin-6-yl]-N-[2-(hydroxymethyl)-3-methylbut-3-enyl]formamide.
| Compound Name | N-[4-[4-[[2-(aminomethylideneamino)-4-pyridinyl]oxy]-3-methylanilino]quinazolin-6-yl]-N-[2-(hydroxymethyl)-3-methylbut-3-enyl]formamide |
|---|---|
| PubChem CID | 167135606 |
| Molecular Formula | C28H29N7O3 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | N-[4-[4-[[2-(aminomethylideneamino)-4-pyridinyl]oxy]-3-methylanilino]quinazolin-6-yl]-N-[2-(hydroxymethyl)-3-methylbut-3-enyl]formamide |
| SMILES | C=C(C)C(CO)CN(C=O)c1ccc2ncnc(Nc3ccc(Oc4ccnc(/N=C/N)c4)c(C)c3)c2c1 |
| InChI | InChI=1S/C28H29N7O3/c1-18(2)20(14-36)13-35(17-37)22-5-6-25-24(11-22)28(33-16-32-25)34-21-4-7-26(19(3)10-21)38-23-8-9-30-27(12-23)31-15-29/h4-12,15-17,20,36H,1,13-14H2,2-3H3,(H2,29,30,31)(H,32,33,34) |
| InChIKey | BGUAQIHXBXSZAU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|