C16H34O3 — CID 167138738
2-ethoxy-6-(2-methoxyethoxy)-2,3,3,6-tetramethylheptane (PubChem CID 167138738) has the molecular formula C16H34O3 and a molecular weight of 274.44 g/mol. Its IUPAC name is 2-ethoxy-6-(2-methoxyethoxy)-2,3,3,6-tetramethylheptane.
| Compound Name | 2-ethoxy-6-(2-methoxyethoxy)-2,3,3,6-tetramethylheptane |
|---|---|
| PubChem CID | 167138738 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | 2-ethoxy-6-(2-methoxyethoxy)-2,3,3,6-tetramethylheptane |
| SMILES | CCOC(C)(C)C(C)(C)CCC(C)(C)OCCOC |
| InChI | InChI=1S/C16H34O3/c1-9-18-16(6,7)14(2,3)10-11-15(4,5)19-13-12-17-8/h9-13H2,1-8H3 |
| InChIKey | CMXYCXIIINNPIF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|