C15H22N4O3 — CID 167139818
2-(2,2-dimethylmorpholin-4-yl)-N-(5-formamido-6-methyl-3-pyridinyl)acetamide (PubChem CID 167139818) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-(2,2-dimethylmorpholin-4-yl)-N-(5-formamido-6-methyl-3-pyridinyl)acetamide.
| Compound Name | 2-(2,2-dimethylmorpholin-4-yl)-N-(5-formamido-6-methyl-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 167139818 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-(2,2-dimethylmorpholin-4-yl)-N-(5-formamido-6-methyl-3-pyridinyl)acetamide |
| SMILES | Cc1ncc(NC(=O)CN2CCOC(C)(C)C2)cc1NC=O |
| InChI | InChI=1S/C15H22N4O3/c1-11-13(17-10-20)6-12(7-16-11)18-14(21)8-19-4-5-22-15(2,3)9-19/h6-7,10H,4-5,8-9H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | VIILDQKIILDBGF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|