C30H35F2N5O2S — CID 167140807
N-[3-[C-(2,4-dimethylpiperazin-1-yl)-N-(2-methylsulfanyl-6-propan-2-ylphenyl)carbonimidoyl]-5-fluoro-6-(2-fluoro-6-methoxyphenyl)-2-pyridinyl]formamide (PubChem CID 167140807) has the molecular formula C30H35F2N5O2S and a molecular weight of 567.71 g/mol. Its IUPAC name is N-[3-[C-(2,4-dimethylpiperazin-1-yl)-N-(2-methylsulfanyl-6-propan-2-ylphenyl)carbonimidoyl]-5-fluoro-6-(2-fluoro-6-methoxyphenyl)-2-pyridinyl]formamide.
| Compound Name | N-[3-[C-(2,4-dimethylpiperazin-1-yl)-N-(2-methylsulfanyl-6-propan-2-ylphenyl)carbonimidoyl]-5-fluoro-6-(2-fluoro-6-methoxyphenyl)-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 167140807 |
| Molecular Formula | C30H35F2N5O2S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | N-[3-[C-(2,4-dimethylpiperazin-1-yl)-N-(2-methylsulfanyl-6-propan-2-ylphenyl)carbonimidoyl]-5-fluoro-6-(2-fluoro-6-methoxyphenyl)-2-pyridinyl]formamide |
| SMILES | COc1cccc(F)c1-c1nc(NC=O)c(/C(=N/c2c(SC)cccc2C(C)C)N2CCN(C)CC2C)cc1F |
| InChI | InChI=1S/C30H35F2N5O2S/c1-18(2)20-9-7-12-25(40-6)27(20)35-30(37-14-13-36(4)16-19(37)3)21-15-23(32)28(34-29(21)33-17-38)26-22(31)10-8-11-24(26)39-5/h7-12,15,17-19H,13-14,16H2,1-6H3,(H,33,34,38)/b35-30- |
| InChIKey | YLSXXECJNHTPCV-GXVXDJONSA-N |
| XLogP | 6.16 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|