C34H39F2N5O3S — CID 166662838
[3-fluoro-2-[3-fluoro-6-(methylamino)-5-[C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-N-(2-methylsulfanyl-6-propan-2-ylphenyl)carbonimidoyl]-2-pyridinyl]phenyl] propanoate (PubChem CID 166662838) has the molecular formula C34H39F2N5O3S and a molecular weight of 635.78 g/mol. Its IUPAC name is [3-fluoro-2-[3-fluoro-6-(methylamino)-5-[C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-N-(2-methylsulfanyl-6-propan-2-ylphenyl)carbonimidoyl]-2-pyridinyl]phenyl] propanoate.
| Compound Name | [3-fluoro-2-[3-fluoro-6-(methylamino)-5-[C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-N-(2-methylsulfanyl-6-propan-2-ylphenyl)carbonimidoyl]-2-pyridinyl]phenyl] propanoate |
|---|---|
| PubChem CID | 166662838 |
| Molecular Formula | C34H39F2N5O3S |
| Molecular Weight | 635.78 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | [3-fluoro-2-[3-fluoro-6-(methylamino)-5-[C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-N-(2-methylsulfanyl-6-propan-2-ylphenyl)carbonimidoyl]-2-pyridinyl]phenyl] propanoate |
| SMILES | C=CC(=O)N1CCN(/C(=N\c2c(SC)cccc2C(C)C)c2cc(F)c(-c3c(F)cccc3OC(=O)CC)nc2NC)C(C)C1 |
| InChI | InChI=1S/C34H39F2N5O3S/c1-8-28(42)40-16-17-41(21(5)19-40)34(39-31-22(20(3)4)12-10-15-27(31)45-7)23-18-25(36)32(38-33(23)37-6)30-24(35)13-11-14-26(30)44-29(43)9-2/h8,10-15,18,20-21H,1,9,16-17,19H2,2-7H3,(H,37,38)/b39-34- |
| InChIKey | GOVZDNPRIYFMAU-RSHGFABKSA-N |
| XLogP | 7.03 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.78 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|