C31H34ClFN6O2S — CID 166891426
N-[6-(2-chlorophenyl)-5-fluoro-3-[N-methyl-C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)carbonimidoyl]-2-pyridinyl]-N-(2-methylsulfanyl-4-propan-2-yl-3-pyridinyl)formamide (PubChem CID 166891426) has the molecular formula C31H34ClFN6O2S and a molecular weight of 609.17 g/mol. Its IUPAC name is N-[6-(2-chlorophenyl)-5-fluoro-3-[N-methyl-C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)carbonimidoyl]-2-pyridinyl]-N-(2-methylsulfanyl-4-propan-2-yl-3-pyridinyl)formamide.
| Compound Name | N-[6-(2-chlorophenyl)-5-fluoro-3-[N-methyl-C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)carbonimidoyl]-2-pyridinyl]-N-(2-methylsulfanyl-4-propan-2-yl-3-pyridinyl)formamide |
|---|---|
| PubChem CID | 166891426 |
| Molecular Formula | C31H34ClFN6O2S |
| Molecular Weight | 609.17 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | N-[6-(2-chlorophenyl)-5-fluoro-3-[N-methyl-C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)carbonimidoyl]-2-pyridinyl]-N-(2-methylsulfanyl-4-propan-2-yl-3-pyridinyl)formamide |
| SMILES | C=CC(=O)N1CCN(/C(=N\C)c2cc(F)c(-c3ccccc3Cl)nc2N(C=O)c2c(C(C)C)ccnc2SC)C(C)C1 |
| InChI | InChI=1S/C31H34ClFN6O2S/c1-7-26(41)37-14-15-38(20(4)17-37)29(34-5)23-16-25(33)27(22-10-8-9-11-24(22)32)36-30(23)39(18-40)28-21(19(2)3)12-13-35-31(28)42-6/h7-13,16,18-20H,1,14-15,17H2,2-6H3/b34-29- |
| InChIKey | DFEGUNWJVZWCSW-BNIPGBBVSA-N |
| XLogP | 6.17 |
| TPSA | 82.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.17 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|