C31H41ClN6O2 — CID 170281993
N-[5-chloro-3-[N-methyl-C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)carbonimidoyl]-6-(3-methylpyrrolidin-1-yl)-2-pyridinyl]-N-(2,6-diethylphenyl)formamide (PubChem CID 170281993) has the molecular formula C31H41ClN6O2 and a molecular weight of 565.16 g/mol. Its IUPAC name is N-[5-chloro-3-[N-methyl-C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)carbonimidoyl]-6-(3-methylpyrrolidin-1-yl)-2-pyridinyl]-N-(2,6-diethylphenyl)formamide.
| Compound Name | N-[5-chloro-3-[N-methyl-C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)carbonimidoyl]-6-(3-methylpyrrolidin-1-yl)-2-pyridinyl]-N-(2,6-diethylphenyl)formamide |
|---|---|
| PubChem CID | 170281993 |
| Molecular Formula | C31H41ClN6O2 |
| Molecular Weight | 565.16 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | N-[5-chloro-3-[N-methyl-C-(2-methyl-4-prop-2-enoylpiperazin-1-yl)carbonimidoyl]-6-(3-methylpyrrolidin-1-yl)-2-pyridinyl]-N-(2,6-diethylphenyl)formamide |
| SMILES | C=CC(=O)N1CCN(/C(=N\C)c2cc(Cl)c(N3CCC(C)C3)nc2N(C=O)c2c(CC)cccc2CC)C(C)C1 |
| InChI | InChI=1S/C31H41ClN6O2/c1-7-23-11-10-12-24(8-2)28(23)38(20-39)30-25(17-26(32)31(34-30)36-14-13-21(4)18-36)29(33-6)37-16-15-35(19-22(37)5)27(40)9-3/h9-12,17,20-22H,3,7-8,13-16,18-19H2,1-2,4-6H3/b33-29- |
| InChIKey | KACBCEKVYOADMU-IYOYZZHUSA-N |
| XLogP | 5.10 |
| TPSA | 72.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.16 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|