C29H40ClFN6O — CID 170281966
N-[3-[N-but-3-enyl-N'-methyl-N-[1-(methylamino)propan-2-yl]carbamimidoyl]-5-chloro-6-(3-fluoroazetidin-1-yl)-2-pyridinyl]-N-(2,6-diethylphenyl)formamide (PubChem CID 170281966) has the molecular formula C29H40ClFN6O and a molecular weight of 543.13 g/mol. Its IUPAC name is N-[3-[N-but-3-enyl-N'-methyl-N-[1-(methylamino)propan-2-yl]carbamimidoyl]-5-chloro-6-(3-fluoroazetidin-1-yl)-2-pyridinyl]-N-(2,6-diethylphenyl)formamide.
| Compound Name | N-[3-[N-but-3-enyl-N'-methyl-N-[1-(methylamino)propan-2-yl]carbamimidoyl]-5-chloro-6-(3-fluoroazetidin-1-yl)-2-pyridinyl]-N-(2,6-diethylphenyl)formamide |
|---|---|
| PubChem CID | 170281966 |
| Molecular Formula | C29H40ClFN6O |
| Molecular Weight | 543.13 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | N-[3-[N-but-3-enyl-N'-methyl-N-[1-(methylamino)propan-2-yl]carbamimidoyl]-5-chloro-6-(3-fluoroazetidin-1-yl)-2-pyridinyl]-N-(2,6-diethylphenyl)formamide |
| SMILES | C=CCCN(/C(=N\C)c1cc(Cl)c(N2CC(F)C2)nc1N(C=O)c1c(CC)cccc1CC)C(C)CNC |
| InChI | InChI=1S/C29H40ClFN6O/c1-7-10-14-36(20(4)16-32-5)27(33-6)24-15-25(30)29(35-17-23(31)18-35)34-28(24)37(19-38)26-21(8-2)12-11-13-22(26)9-3/h7,11-13,15,19-20,23,32H,1,8-10,14,16-18H2,2-6H3/b33-27- |
| InChIKey | NTTAJHHHVNEMGQ-KGGMANCPSA-N |
| XLogP | 5.17 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.13 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|