C20H38N4O4 — CID 167146936
methyl 2-[7,10-diethyl-1-(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclotetradec-12-en-4-yl]acetate (PubChem CID 167146936) has the molecular formula C20H38N4O4 and a molecular weight of 398.55 g/mol. Its IUPAC name is methyl 2-[7,10-diethyl-1-(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclotetradec-12-en-4-yl]acetate.
| Compound Name | methyl 2-[7,10-diethyl-1-(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclotetradec-12-en-4-yl]acetate |
|---|---|
| PubChem CID | 167146936 |
| Molecular Formula | C20H38N4O4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | methyl 2-[7,10-diethyl-1-(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclotetradec-12-en-4-yl]acetate |
| SMILES | CCN1CC=CCN(CC(=O)OC)CCN(CC(=O)OC)CCN(CC)CC1 |
| InChI | InChI=1S/C20H38N4O4/c1-5-21-9-7-8-10-23(17-19(25)27-3)15-16-24(18-20(26)28-4)14-13-22(6-2)12-11-21/h7-8H,5-6,9-18H2,1-4H3 |
| InChIKey | OGXLJYMRRAWCMO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|