C15H26N6O — CID 167147075
2-(tert-butylamino)-4-[(3-hydroxycyclohexyl)amino]pyrimidine-5-carboximidamide (PubChem CID 167147075) has the molecular formula C15H26N6O and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(tert-butylamino)-4-[(3-hydroxycyclohexyl)amino]pyrimidine-5-carboximidamide.
| Compound Name | 2-(tert-butylamino)-4-[(3-hydroxycyclohexyl)amino]pyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 167147075 |
| Molecular Formula | C15H26N6O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-(tert-butylamino)-4-[(3-hydroxycyclohexyl)amino]pyrimidine-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(NC(C)(C)C)nc1NC1CCCC(O)C1 |
| InChI | InChI=1S/C15H26N6O/c1-15(2,3)21-14-18-8-11(12(16)17)13(20-14)19-9-5-4-6-10(22)7-9/h8-10,22H,4-7H2,1-3H3,(H3,16,17)(H2,18,19,20,21) |
| InChIKey | NNBSRWNQOQBDAP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 119.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|