C18H26O4 — CID 167147145
Propan-2-yl 6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexanoate (PubChem CID 167147145) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is propan-2-yl 6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexanoate.
| Compound Name | Propan-2-yl 6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexanoate |
|---|---|
| PubChem CID | 167147145 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | propan-2-yl 6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexanoate |
| SMILES | CC1=C(C(=O)C(=C(C1=O)C)CCCCCC(=O)OC(C)C)C |
| InChI | InChI=1S/C18H26O4/c1-11(2)22-16(19)10-8-6-7-9-15-14(5)17(20)12(3)13(4)18(15)21/h11H,6-10H2,1-5H3 |
| InChIKey | VOZHJLNMWJWYPY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | 535 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|